Esterification: examples of unsaturated and saturated fatty acids

 

Unsaturated fatty acids

 

Common name

Chemical structure

Δx

C:D

nx

Myristoleic acid

CH3(CH2)3CH=CH(CH2)7COOH

cis-Δ9

14:1

n−5

Palmitoleic acid

CH3(CH2)5CH=CH(CH2)7COOH

cis-Δ9

16:1

n−7

Sapienic acid

CH3(CH2)8CH=CH(CH2)4COOH

cis-Δ6

16:1

n−10

Oleic acid

CH3(CH2)7CH=CH(CH2)7COOH

cis-Δ9

18:1

n−9

Elaidic acid

CH3(CH2)7CH=CH(CH2)7COOH

trans-Δ9

18:1

n−9

Vaccenic acid

CH3(CH2)5CH=CH(CH2)9COOH

trans-Δ11

18:1

n−7

Linoleic acid

CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH

cis,cis-Δ9,Δ12

18:2

n−6

Arachidonic acid

CH3(CH2)4CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2)3COOHNIST

cis,cis,cis,cis-Δ5Δ8,Δ11,Δ14

20:4

n−6

Erucic acid

CH3(CH2)7CH=CH(CH2)11COOH

cis-Δ13

22:1

n−9

 

 

Saturated fatty acids

 

Common name

Chemical structure

C:D

Caprylic acid

CH3(CH2)6COOH

8:0

Capric acid

CH3(CH2)8COOH

10:0

Lauric acid

CH3(CH2)10COOH

12:0

Myristic acid

CH3(CH2)12COOH

14:0

Palmitic acid

CH3(CH2)14COOH

16:0

Stearic acid

CH3(CH2)16COOH

18:0

Arachidic acid

CH3(CH2)18COOH

20:0

Behenic acid

CH3(CH2)20COOH

22:0

Lignoceric acid

CH3(CH2)22COOH

24:0

Cerotic acid

CH3(CH2)24COOH

26:0